C25H25ClN2O6 — CID 126137339
(5E)-5-[(5-chloro-2-prop-2-enoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126137339) has the molecular formula C25H25ClN2O6 and a molecular weight of 484.94 g/mol. Its IUPAC name is (5E)-5-[(5-chloro-2-prop-2-enoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(5-chloro-2-prop-2-enoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126137339 |
| Molecular Formula | C25H25ClN2O6 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (5E)-5-[(5-chloro-2-prop-2-enoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCOc1ccc(Cl)cc1/C=C1\C(=O)NC(=O)N(Cc2ccc(OCCC)c(OC)c2)C1=O |
| InChI | InChI=1S/C25H25ClN2O6/c1-4-10-33-20-9-7-18(26)13-17(20)14-19-23(29)27-25(31)28(24(19)30)15-16-6-8-21(34-11-5-2)22(12-16)32-3/h4,6-9,12-14H,1,5,10-11,15H2,2-3H3,(H,27,29,31)/b19-14+ |
| InChIKey | MSEOUGLKQBWYDV-XMHGGMMESA-N |
| XLogP | 4.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|