C29H24Br2Cl2N2O6 — CID 126155426
(5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126155426) has the molecular formula C29H24Br2Cl2N2O6 and a molecular weight of 727.23 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126155426 |
| Molecular Formula | C29H24Br2Cl2N2O6 |
| Molecular Weight | 727.23 g/mol |
| Exact Mass | 723.94 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)cc(Br)c3OCc3ccc(Cl)cc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C29H24Br2Cl2N2O6/c1-3-8-40-24-7-4-16(9-25(24)39-2)14-35-28(37)21(27(36)34-29(35)38)11-18-10-19(30)12-22(31)26(18)41-15-17-5-6-20(32)13-23(17)33/h4-7,9-13H,3,8,14-15H2,1-2H3,(H,34,36,38)/b21-11+ |
| InChIKey | YBHRDRNQGHYYBS-SRZZPIQSSA-N |
| XLogP | 7.56 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.23 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|