C29H27BrN2O6 — CID 126134920
(5E)-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126134920) has the molecular formula C29H27BrN2O6 and a molecular weight of 579.45 g/mol. Its IUPAC name is (5E)-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126134920 |
| Molecular Formula | C29H27BrN2O6 |
| Molecular Weight | 579.45 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | (5E)-5-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3ccccc3OCc3ccc(Br)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C29H27BrN2O6/c1-3-14-37-25-13-10-20(15-26(25)36-2)17-32-28(34)23(27(33)31-29(32)35)16-21-6-4-5-7-24(21)38-18-19-8-11-22(30)12-9-19/h4-13,15-16H,3,14,17-18H2,1-2H3,(H,31,33,35)/b23-16+ |
| InChIKey | FVLXIFAPIXINFX-XQNSMLJCSA-N |
| XLogP | 5.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|