C26H30N2O7 — CID 4604591
5-[(3,4-diethoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 4604591) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 5-[(3,4-diethoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3,4-diethoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4604591 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 5-[(3,4-diethoxyphenyl)methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)C(=Cc3ccc(OCC)c(OCC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C26H30N2O7/c1-5-12-35-20-11-9-18(15-22(20)32-4)16-28-25(30)19(24(29)27-26(28)31)13-17-8-10-21(33-6-2)23(14-17)34-7-3/h8-11,13-15H,5-7,12,16H2,1-4H3,(H,27,29,31) |
| InChIKey | ARXNAFUTTSHLTI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|