C23H23BrN2O6 — CID 126197259
(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126197259) has the molecular formula C23H23BrN2O6 and a molecular weight of 503.35 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126197259 |
| Molecular Formula | C23H23BrN2O6 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3ccc(O)c(Br)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C23H23BrN2O6/c1-3-9-32-19-8-6-15(12-20(19)31-4-2)13-26-22(29)16(21(28)25-23(26)30)10-14-5-7-18(27)17(24)11-14/h5-8,10-12,27H,3-4,9,13H2,1-2H3,(H,25,28,30)/b16-10+ |
| InChIKey | YTUKNUMLRKONSV-MHWRWJLKSA-N |
| XLogP | 4.00 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|