C25H24Br2N2O8 — CID 126195898
2-[2,6-dibromo-4-[(E)-[1-[(3-ethoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126195898) has the molecular formula C25H24Br2N2O8 and a molecular weight of 640.28 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-[(3-ethoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-[(3-ethoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126195898 |
| Molecular Formula | C25H24Br2N2O8 |
| Molecular Weight | 640.28 g/mol |
| Exact Mass | 637.99 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-[(3-ethoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCC(=O)O)c(Br)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C25H24Br2N2O8/c1-3-7-36-19-6-5-14(11-20(19)35-4-2)12-29-24(33)16(23(32)28-25(29)34)8-15-9-17(26)22(18(27)10-15)37-13-21(30)31/h5-6,8-11H,3-4,7,12-13H2,1-2H3,(H,30,31)(H,28,32,34)/b16-8+ |
| InChIKey | MKDMOPZBZLAJEB-LZYBPNLTSA-N |
| XLogP | 4.52 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|