C24H22Br2N2O8 — CID 126140728
2-[2,6-dibromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126140728) has the molecular formula C24H22Br2N2O8 and a molecular weight of 626.25 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126140728 |
| Molecular Formula | C24H22Br2N2O8 |
| Molecular Weight | 626.25 g/mol |
| Exact Mass | 623.97 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCC(=O)O)c(Br)c3)C2=O)cc1OC |
| InChI | InChI=1S/C24H22Br2N2O8/c1-3-6-35-18-5-4-13(10-19(18)34-2)11-28-23(32)15(22(31)27-24(28)33)7-14-8-16(25)21(17(26)9-14)36-12-20(29)30/h4-5,7-10H,3,6,11-12H2,1-2H3,(H,29,30)(H,27,31,33)/b15-7+ |
| InChIKey | SQDOYPMTFSFYKN-VIZOYTHASA-N |
| XLogP | 4.13 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|