C30H28Cl2N2O7 — CID 126141078
(5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126141078) has the molecular formula C30H28Cl2N2O7 and a molecular weight of 599.47 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126141078 |
| Molecular Formula | C30H28Cl2N2O7 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | (5E)-5-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Cl)c(OCc4ccc(Cl)cc4)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C30H28Cl2N2O7/c1-4-11-40-24-10-7-19(14-25(24)38-2)16-34-29(36)22(28(35)33-30(34)37)12-20-13-23(32)27(26(15-20)39-3)41-17-18-5-8-21(31)9-6-18/h5-10,12-15H,4,11,16-17H2,1-3H3,(H,33,35,37)/b22-12+ |
| InChIKey | PXZDEATYWYOWFX-WSDLNYQXSA-N |
| XLogP | 6.04 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|