C32H33IN2O7 — CID 126139216
(5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126139216) has the molecular formula C32H33IN2O7 and a molecular weight of 684.53 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126139216 |
| Molecular Formula | C32H33IN2O7 |
| Molecular Weight | 684.53 g/mol |
| Exact Mass | 684.13 |
| IUPAC Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(I)c(OCc4ccc(C)cc4)c(OCC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C32H33IN2O7/c1-5-13-41-26-12-11-22(16-27(26)39-4)18-35-31(37)24(30(36)34-32(35)38)14-23-15-25(33)29(28(17-23)40-6-2)42-19-21-9-7-20(3)8-10-21/h7-12,14-17H,5-6,13,18-19H2,1-4H3,(H,34,36,38)/b24-14+ |
| InChIKey | PIGKQQYOFZLLKU-ZVHZXABRSA-N |
| XLogP | 6.04 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|