C31H32N2O6 — CID 126194864
(5Z)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126194864) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is (5Z)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126194864 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (5Z)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[3-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C/c3cccc(OCc4ccc(C)cc4)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C31H32N2O6/c1-4-15-38-27-14-13-24(18-28(27)37-5-2)19-33-30(35)26(29(34)32-31(33)36)17-23-7-6-8-25(16-23)39-20-22-11-9-21(3)10-12-22/h6-14,16-18H,4-5,15,19-20H2,1-3H3,(H,32,34,36)/b26-17- |
| InChIKey | IBVQROJXNZZHPQ-ONUIUJJFSA-N |
| XLogP | 5.42 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|