C32H33FN2O7 — CID 126198239
(5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126198239) has the molecular formula C32H33FN2O7 and a molecular weight of 576.62 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126198239 |
| Molecular Formula | C32H33FN2O7 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3ccc(OCc4ccccc4F)c(OCC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C32H33FN2O7/c1-4-15-41-26-14-12-22(18-29(26)40-6-3)19-35-31(37)24(30(36)34-32(35)38)16-21-11-13-27(28(17-21)39-5-2)42-20-23-9-7-8-10-25(23)33/h7-14,16-18H,4-6,15,19-20H2,1-3H3,(H,34,36,38)/b24-16+ |
| InChIKey | SFUSOODKKUZLII-LFVJCYFKSA-N |
| XLogP | 5.65 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|