C31H30FIN2O7 — CID 126193913
(5E)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126193913) has the molecular formula C31H30FIN2O7 and a molecular weight of 688.49 g/mol. Its IUPAC name is (5E)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126193913 |
| Molecular Formula | C31H30FIN2O7 |
| Molecular Weight | 688.49 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | (5E)-1-[(3-ethoxy-4-propoxyphenyl)methyl]-5-[[4-[(3-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(I)c(OCc4cccc(F)c4)c(OC)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C31H30FIN2O7/c1-4-11-41-25-10-9-19(15-26(25)40-5-2)17-35-30(37)23(29(36)34-31(35)38)13-21-14-24(33)28(27(16-21)39-3)42-18-20-7-6-8-22(32)12-20/h6-10,12-16H,4-5,11,17-18H2,1-3H3,(H,34,36,38)/b23-13+ |
| InChIKey | AMCVGZBRRFZNMQ-YDZHTSKRSA-N |
| XLogP | 5.87 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|