C31H29IN2O9 — CID 126129113
4-[[2-iodo-6-methoxy-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126129113) has the molecular formula C31H29IN2O9 and a molecular weight of 700.48 g/mol. Its IUPAC name is 4-[[2-iodo-6-methoxy-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-iodo-6-methoxy-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126129113 |
| Molecular Formula | C31H29IN2O9 |
| Molecular Weight | 700.48 g/mol |
| Exact Mass | 700.09 |
| IUPAC Name | 4-[[2-iodo-6-methoxy-4-[(E)-[1-[(3-methoxy-4-propoxyphenyl)methyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(I)c(OCc4ccc(C(=O)O)cc4)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C31H29IN2O9/c1-4-11-42-24-10-7-19(14-25(24)40-2)16-34-29(36)22(28(35)33-31(34)39)12-20-13-23(32)27(26(15-20)41-3)43-17-18-5-8-21(9-6-18)30(37)38/h5-10,12-15H,4,11,16-17H2,1-3H3,(H,37,38)(H,33,35,39)/b22-12+ |
| InChIKey | BVKRXJFYGVKWQG-WSDLNYQXSA-N |
| XLogP | 5.04 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|