C26H23IN2O6 — CID 126379106
(5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126379106) has the molecular formula C26H23IN2O6 and a molecular weight of 586.38 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126379106 |
| Molecular Formula | C26H23IN2O6 |
| Molecular Weight | 586.38 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(Cc3ccco3)C2=O)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C26H23IN2O6/c1-3-33-22-13-18(12-21(27)23(22)35-15-17-8-6-16(2)7-9-17)11-20-24(30)28-26(32)29(25(20)31)14-19-5-4-10-34-19/h4-13H,3,14-15H2,1-2H3,(H,28,30,32)/b20-11+ |
| InChIKey | RNORTHDNDITYEZ-RGVLZGJSSA-N |
| XLogP | 4.83 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|