C19H14I2N2O5 — CID 126376306
(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126376306) has the molecular formula C19H14I2N2O5 and a molecular weight of 604.14 g/mol. Its IUPAC name is (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126376306 |
| Molecular Formula | C19H14I2N2O5 |
| Molecular Weight | 604.14 g/mol |
| Exact Mass | 603.90 |
| IUPAC Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-1-(furan-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCOc1c(I)cc(/C=C2\C(=O)NC(=O)N(Cc3ccco3)C2=O)cc1I |
| InChI | InChI=1S/C19H14I2N2O5/c1-2-5-28-16-14(20)8-11(9-15(16)21)7-13-17(24)22-19(26)23(18(13)25)10-12-4-3-6-27-12/h2-4,6-9H,1,5,10H2,(H,22,24,26)/b13-7+ |
| InChIKey | FXWVKYCYJMUGRM-NTUHNPAUSA-N |
| XLogP | 3.72 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|