C30H26Cl4N2O6 — CID 126196151
(5E)-5-[[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126196151) has the molecular formula C30H26Cl4N2O6 and a molecular weight of 652.36 g/mol. Its IUPAC name is (5E)-5-[[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126196151 |
| Molecular Formula | C30H26Cl4N2O6 |
| Molecular Weight | 652.36 g/mol |
| Exact Mass | 650.05 |
| IUPAC Name | (5E)-5-[[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Cl)cc(Cl)c3OCc3ccc(Cl)cc3Cl)C2=O)cc1OCC |
| InChI | InChI=1S/C30H26Cl4N2O6/c1-3-9-41-25-8-5-17(10-26(25)40-4-2)15-36-29(38)22(28(37)35-30(36)39)12-19-11-21(32)14-24(34)27(19)42-16-18-6-7-20(31)13-23(18)33/h5-8,10-14H,3-4,9,15-16H2,1-2H3,(H,35,37,39)/b22-12+ |
| InChIKey | NLXOGEBNERJDEN-WSDLNYQXSA-N |
| XLogP | 7.73 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.36 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|