C23H22Cl2N2O6 — CID 126199170
(5E)-5-[(3,5-dichloro-2-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126199170) has the molecular formula C23H22Cl2N2O6 and a molecular weight of 493.34 g/mol. Its IUPAC name is (5E)-5-[(3,5-dichloro-2-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3,5-dichloro-2-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126199170 |
| Molecular Formula | C23H22Cl2N2O6 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | (5E)-5-[(3,5-dichloro-2-hydroxyphenyl)methylidene]-1-[(3-ethoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(CN2C(=O)NC(=O)/C(=C\c3cc(Cl)cc(Cl)c3O)C2=O)cc1OCC |
| InChI | InChI=1S/C23H22Cl2N2O6/c1-3-7-33-18-6-5-13(8-19(18)32-4-2)12-27-22(30)16(21(29)26-23(27)31)10-14-9-15(24)11-17(25)20(14)28/h5-6,8-11,28H,3-4,7,12H2,1-2H3,(H,26,29,31)/b16-10+ |
| InChIKey | GKBIXACDZBYUMO-MHWRWJLKSA-N |
| XLogP | 4.55 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|