C34H35ClN2O7 — CID 126133569
(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126133569) has the molecular formula C34H35ClN2O7 and a molecular weight of 619.11 g/mol. Its IUPAC name is (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126133569 |
| Molecular Formula | C34H35ClN2O7 |
| Molecular Weight | 619.11 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-1-[(3-methoxy-4-propoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(Cc3ccc(OCCC)c(OC)c3)C2=O)cc(OCC)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C34H35ClN2O7/c1-5-10-24-16-23(19-30(42-7-3)31(24)44-21-25-11-8-9-12-27(25)35)17-26-32(38)36-34(40)37(33(26)39)20-22-13-14-28(43-15-6-2)29(18-22)41-4/h5,8-9,11-14,16-19H,1,6-7,10,15,20-21H2,2-4H3,(H,36,38,40)/b26-17+ |
| InChIKey | CTSUDLXYBJXFFC-YZSQISJMSA-N |
| XLogP | 6.51 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.11 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|