C27H26ClNO3 — CID 126124331
(3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-propylindol-2-one (PubChem CID 126124331) has the molecular formula C27H26ClNO3 and a molecular weight of 447.96 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-propylindol-2-one.
| Compound Name | (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-propylindol-2-one |
|---|---|
| PubChem CID | 126124331 |
| Molecular Formula | C27H26ClNO3 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-propylindol-2-one |
| SMILES | CCCN1C(=O)/C(=C\c2ccc(OCc3ccccc3Cl)c(OCC)c2)c2ccccc21 |
| InChI | InChI=1S/C27H26ClNO3/c1-3-15-29-24-12-8-6-10-21(24)22(27(29)30)16-19-13-14-25(26(17-19)31-4-2)32-18-20-9-5-7-11-23(20)28/h5-14,16-17H,3-4,15,18H2,1-2H3/b22-16- |
| InChIKey | MOXUWIISJIOYAW-JWGURIENSA-N |
| XLogP | 6.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|