C23H24ClNO3 — CID 126127135
(3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-propylindol-2-one (PubChem CID 126127135) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-propylindol-2-one.
| Compound Name | (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-propylindol-2-one |
|---|---|
| PubChem CID | 126127135 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (3Z)-3-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1-propylindol-2-one |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\C(=O)N(CCC)c3ccccc32)cc1OCC |
| InChI | InChI=1S/C23H24ClNO3/c1-4-11-25-20-10-8-7-9-17(20)18(23(25)26)13-16-14-19(24)22(28-12-5-2)21(15-16)27-6-3/h5,7-10,13-15H,2,4,6,11-12H2,1,3H3/b18-13- |
| InChIKey | UVADIKYEQJKWLW-AQTBWJFISA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|