C22H18Cl3NO4S — CID 2719964
(5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2719964) has the molecular formula C22H18Cl3NO4S and a molecular weight of 498.82 g/mol. Its IUPAC name is (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2719964 |
| Molecular Formula | C22H18Cl3NO4S |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | (5Z)-5-[(3-chloro-5-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)cc1OCC |
| InChI | InChI=1S/C22H18Cl3NO4S/c1-3-8-30-20-17(25)9-13(10-18(20)29-4-2)11-19-21(27)26(22(28)31-19)12-14-15(23)6-5-7-16(14)24/h3,5-7,9-11H,1,4,8,12H2,2H3/b19-11- |
| InChIKey | RKPQMDQQWNBZRH-ODLFYWEKSA-N |
| XLogP | 6.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|