C26H19Cl4NO4S — CID 4063359
5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4063359) has the molecular formula C26H19Cl4NO4S and a molecular weight of 583.32 g/mol. Its IUPAC name is 5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4063359 |
| Molecular Formula | C26H19Cl4NO4S |
| Molecular Weight | 583.32 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[(2,6-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19Cl4NO4S/c1-2-34-23-11-15(7-9-22(23)35-14-16-6-8-20(29)21(30)10-16)12-24-25(32)31(26(33)36-24)13-17-18(27)4-3-5-19(17)28/h3-12H,2,13-14H2,1H3 |
| InChIKey | LAYSYGGSVVFWAW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.32 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|