C30H28Cl2N2O5S — CID 126379266
2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126379266) has the molecular formula C30H28Cl2N2O5S and a molecular weight of 599.54 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126379266 |
| Molecular Formula | C30H28Cl2N2O5S |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3c(C)cc(C)cc3C)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H28Cl2N2O5S/c1-5-38-25-13-20(7-9-24(25)39-16-21-6-8-22(31)23(32)12-21)14-26-29(36)34(30(37)40-26)15-27(35)33-28-18(3)10-17(2)11-19(28)4/h6-14H,5,15-16H2,1-4H3,(H,33,35)/b26-14+ |
| InChIKey | WHIXWAMWWSTNPC-VULFUBBASA-N |
| XLogP | 7.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|