C27H19Cl2F3N2O5S — CID 126256542
2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126256542) has the molecular formula C27H19Cl2F3N2O5S and a molecular weight of 611.43 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126256542 |
| Molecular Formula | C27H19Cl2F3N2O5S |
| Molecular Weight | 611.43 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | 2-[(5E)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(F)c(F)c3F)C2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H19Cl2F3N2O5S/c1-2-38-21-10-14(4-8-20(21)39-13-15-3-5-16(28)17(29)9-15)11-22-26(36)34(27(37)40-22)12-23(35)33-19-7-6-18(30)24(31)25(19)32/h3-11H,2,12-13H2,1H3,(H,33,35)/b22-11+ |
| InChIKey | KLMWSHCUJCLZBY-SSDVNMTOSA-N |
| XLogP | 7.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.43 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|