C26H23ClFNO3 — CID 126122201
(3Z)-3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one (PubChem CID 126122201) has the molecular formula C26H23ClFNO3 and a molecular weight of 451.93 g/mol. Its IUPAC name is (3Z)-3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126122201 |
| Molecular Formula | C26H23ClFNO3 |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (3Z)-3-[[3-chloro-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(CC)c3ccccc32)cc(Cl)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H23ClFNO3/c1-3-29-23-11-6-5-10-20(23)21(26(29)30)13-18-14-22(27)25(24(15-18)31-4-2)32-16-17-8-7-9-19(28)12-17/h5-15H,3-4,16H2,1-2H3/b21-13- |
| InChIKey | LLNZJFYCPAGQHY-BKUYFWCQSA-N |
| XLogP | 6.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|