C26H24ClNO3 — CID 126120705
(3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-ethylindol-2-one (PubChem CID 126120705) has the molecular formula C26H24ClNO3 and a molecular weight of 433.94 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126120705 |
| Molecular Formula | C26H24ClNO3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (3Z)-3-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-ethylindol-2-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(CC)c3ccccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H24ClNO3/c1-3-28-23-12-8-6-10-20(23)21(26(28)29)15-18-13-14-24(25(16-18)30-4-2)31-17-19-9-5-7-11-22(19)27/h5-16H,3-4,17H2,1-2H3/b21-15- |
| InChIKey | JJJADLOGUOKRRW-QNGOZBTKSA-N |
| XLogP | 6.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|