C24H19Cl2NO2 — CID 126119921
(3Z)-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one (PubChem CID 126119921) has the molecular formula C24H19Cl2NO2 and a molecular weight of 424.33 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126119921 |
| Molecular Formula | C24H19Cl2NO2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (3Z)-3-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OCc3ccc(Cl)cc3Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H19Cl2NO2/c1-2-27-23-6-4-3-5-20(23)21(24(27)28)13-16-7-11-19(12-8-16)29-15-17-9-10-18(25)14-22(17)26/h3-14H,2,15H2,1H3/b21-13- |
| InChIKey | DTAFPJRTWWJZTC-BKUYFWCQSA-N |
| XLogP | 6.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|