C26H24ClNO2 — CID 126126405
(3Z)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126126405) has the molecular formula C26H24ClNO2 and a molecular weight of 417.94 g/mol. Its IUPAC name is (3Z)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126126405 |
| Molecular Formula | C26H24ClNO2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (3Z)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CC(C)CN1C(=O)/C(=C\c2ccc(OCc3ccc(Cl)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H24ClNO2/c1-18(2)16-28-25-6-4-3-5-23(25)24(26(28)29)15-19-9-13-22(14-10-19)30-17-20-7-11-21(27)12-8-20/h3-15,18H,16-17H2,1-2H3/b24-15- |
| InChIKey | XYDXCKZRZIQOIG-IWIPYMOSSA-N |
| XLogP | 6.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|