C25H25N3O4S — CID 3982945
2-[[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 3982945) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3982945 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(C=C2C(=O)N(CC)C(=S)N(CC)C2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H25N3O4S/c1-4-27-23(29)20(24(30)28(5-2)25(27)33)13-17-11-12-21(22(14-17)31-6-3)32-16-19-10-8-7-9-18(19)15-26/h7-14H,4-6,16H2,1-3H3 |
| InChIKey | YTLOHYAATNSHTK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|