C22H24BrNO3 — CID 126126060
(3Z)-3-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126126060) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is (3Z)-3-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126126060 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (3Z)-3-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CCOc1cc(Br)c(/C=C2\C(=O)N(CC(C)C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C22H24BrNO3/c1-5-27-21-12-18(23)15(11-20(21)26-4)10-17-16-8-6-7-9-19(16)24(22(17)25)13-14(2)3/h6-12,14H,5,13H2,1-4H3/b17-10- |
| InChIKey | UDNYYPSJXSMHEN-YVLHZVERSA-N |
| XLogP | 5.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|