C21H20BrNO5 — CID 126120616
2-[5-bromo-2-methoxy-4-[(Z)-(2-oxo-1-propylindol-3-ylidene)methyl]phenoxy]acetic acid (PubChem CID 126120616) has the molecular formula C21H20BrNO5 and a molecular weight of 446.30 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[(Z)-(2-oxo-1-propylindol-3-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-methoxy-4-[(Z)-(2-oxo-1-propylindol-3-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126120616 |
| Molecular Formula | C21H20BrNO5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[(Z)-(2-oxo-1-propylindol-3-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CCCN1C(=O)/C(=C\c2cc(OC)c(OCC(=O)O)cc2Br)c2ccccc21 |
| InChI | InChI=1S/C21H20BrNO5/c1-3-8-23-17-7-5-4-6-14(17)15(21(23)26)9-13-10-18(27-2)19(11-16(13)22)28-12-20(24)25/h4-7,9-11H,3,8,12H2,1-2H3,(H,24,25)/b15-9- |
| InChIKey | GOZSDKCXZUPZOY-DHDCSXOGSA-N |
| XLogP | 4.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|