C20H19NO4 — CID 126125874
(3Z)-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1-propylindol-2-one (PubChem CID 126125874) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3Z)-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1-propylindol-2-one.
| Compound Name | (3Z)-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1-propylindol-2-one |
|---|---|
| PubChem CID | 126125874 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3Z)-3-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-1-propylindol-2-one |
| SMILES | CCCN1C(=O)/C(=C\c2cc3c(cc2OC)OCO3)c2ccccc21 |
| InChI | InChI=1S/C20H19NO4/c1-3-8-21-16-7-5-4-6-14(16)15(20(21)22)9-13-10-18-19(25-12-24-18)11-17(13)23-2/h4-7,9-11H,3,8,12H2,1-2H3/b15-9- |
| InChIKey | WYEWMPQUSHXSRJ-DHDCSXOGSA-N |
| XLogP | 3.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|