C27H23N3O3 — CID 39861690
3-(2-methoxyphenyl)-2-[(E)-(2-oxo-1-propylindol-3-ylidene)methyl]quinazolin-4-one (PubChem CID 39861690) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[(E)-(2-oxo-1-propylindol-3-ylidene)methyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[(E)-(2-oxo-1-propylindol-3-ylidene)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 39861690 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[(E)-(2-oxo-1-propylindol-3-ylidene)methyl]quinazolin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2nc3ccccc3c(=O)n2-c2ccccc2OC)c2ccccc21 |
| InChI | InChI=1S/C27H23N3O3/c1-3-16-29-22-13-7-5-10-18(22)20(26(29)31)17-25-28-21-12-6-4-11-19(21)27(32)30(25)23-14-8-9-15-24(23)33-2/h4-15,17H,3,16H2,1-2H3/b20-17+ |
| InChIKey | NRAJQZOTJHYXBD-LVZFUZTISA-N |
| XLogP | 4.69 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|