C27H23N3O4 — CID 143618036
2-[4-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]butyl]isoindole-1,3-dione (PubChem CID 143618036) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143618036 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[4-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1ccccc1-n1c(CCCCN2C(=O)c3ccccc3C2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H23N3O4/c1-34-23-15-7-6-14-22(23)30-24(28-21-13-5-4-12-20(21)27(30)33)16-8-9-17-29-25(31)18-10-2-3-11-19(18)26(29)32/h2-7,10-15H,8-9,16-17H2,1H3 |
| InChIKey | ZZFOIRMDCICOSV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|