C16H17BrN2O5S — CID 126038013
2-[5-bromo-4-[(Z)-(1-ethyl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 126038013) has the molecular formula C16H17BrN2O5S and a molecular weight of 429.29 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-(1-ethyl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(Z)-(1-ethyl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126038013 |
| Molecular Formula | C16H17BrN2O5S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-(1-ethyl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | CCN1C(=O)/C(=C/c2cc(OC)c(OCC(=O)O)cc2Br)N(C)C1=S |
| InChI | InChI=1S/C16H17BrN2O5S/c1-4-19-15(22)11(18(2)16(19)25)5-9-6-12(23-3)13(7-10(9)17)24-8-14(20)21/h5-7H,4,8H2,1-3H3,(H,20,21)/b11-5- |
| InChIKey | HGTGPBKNJONZHO-WZUFQYTHSA-N |
| XLogP | 2.34 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|