C15H17BrN2O3S — CID 126036646
(5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126036646) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126036646 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc(OC)c(OC)cc2Br)N(C)C1=S |
| InChI | InChI=1S/C15H17BrN2O3S/c1-5-18-14(19)11(17(2)15(18)22)6-9-7-12(20-3)13(21-4)8-10(9)16/h6-8H,5H2,1-4H3/b11-6- |
| InChIKey | CMQMCKIMJIVURE-WDZFZDKYSA-N |
| XLogP | 2.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|