C16H19BrN2O3S — CID 126048458
(5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126048458) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126048458 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (5Z)-5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(CC)C(=S)N2C)c(Br)cc1OC |
| InChI | InChI=1S/C16H19BrN2O3S/c1-5-19-15(20)12(18(3)16(19)23)7-10-8-14(22-6-2)13(21-4)9-11(10)17/h7-9H,5-6H2,1-4H3/b12-7- |
| InChIKey | XDFKIVRWMOHUJY-GHXNOFRVSA-N |
| XLogP | 3.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|