C23H25BrN2O4S — CID 126047186
(5Z)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126047186) has the molecular formula C23H25BrN2O4S and a molecular weight of 505.43 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126047186 |
| Molecular Formula | C23H25BrN2O4S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | (5Z)-5-[(2-bromo-4,5-diethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(OCC)c(OCC)cc3Br)N(C)C2=S)cc1 |
| InChI | InChI=1S/C23H25BrN2O4S/c1-5-28-17-10-8-16(9-11-17)26-22(27)19(25(4)23(26)31)12-15-13-20(29-6-2)21(30-7-3)14-18(15)24/h8-14H,5-7H2,1-4H3/b19-12- |
| InChIKey | ULSMGYUFTKAVBH-UNOMPAQXSA-N |
| XLogP | 5.25 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|