C28H27BrN2O4S — CID 126044239
(5Z)-5-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126044239) has the molecular formula C28H27BrN2O4S and a molecular weight of 567.51 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126044239 |
| Molecular Formula | C28H27BrN2O4S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | (5Z)-5-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(OCC)c(OCc4ccccc4)cc3Br)N(C)C2=S)cc1 |
| InChI | InChI=1S/C28H27BrN2O4S/c1-4-33-22-13-11-21(12-14-22)31-27(32)24(30(3)28(31)36)15-20-16-25(34-5-2)26(17-23(20)29)35-18-19-9-7-6-8-10-19/h6-17H,4-5,18H2,1-3H3/b24-15- |
| InChIKey | NVICSIJWFQBAIF-IWIPYMOSSA-N |
| XLogP | 6.43 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|