C17H15BrN2O6S — CID 1325025
2-[5-bromo-4-[(Z)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 1325025) has the molecular formula C17H15BrN2O6S and a molecular weight of 455.29 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(Z)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 1325025 |
| Molecular Formula | C17H15BrN2O6S |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | C=CCN1C(=O)/C(=C\c2cc(OC)c(OCC(=O)O)cc2Br)C(=O)NC1=S |
| InChI | InChI=1S/C17H15BrN2O6S/c1-3-4-20-16(24)10(15(23)19-17(20)27)5-9-6-12(25-2)13(7-11(9)18)26-8-14(21)22/h3,5-7H,1,4,8H2,2H3,(H,21,22)(H,19,23,27)/b10-5- |
| InChIKey | ZGUBJISTOHDQEU-YHYXMXQVSA-N |
| XLogP | 1.73 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|