C19H13BrO6 — CID 1010757
2-[5-bromo-4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetic acid (PubChem CID 1010757) has the molecular formula C19H13BrO6 and a molecular weight of 417.21 g/mol. Its IUPAC name is 2-[5-bromo-4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[5-bromo-4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 1010757 |
| Molecular Formula | C19H13BrO6 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 2-[5-bromo-4-[(1,3-dioxoinden-2-ylidene)methyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=C2C(=O)c3ccccc3C2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C19H13BrO6/c1-25-15-7-10(14(20)8-16(15)26-9-17(21)22)6-13-18(23)11-4-2-3-5-12(11)19(13)24/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | JHBXTQWPGLMQRU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|