C20H15BrN2O6S — CID 137065402
2-[4-[(Z)-(2-benzoylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-5-bromo-2-methoxyphenoxy]acetic acid (PubChem CID 137065402) has the molecular formula C20H15BrN2O6S and a molecular weight of 491.32 g/mol. Its IUPAC name is 2-[4-[(Z)-(2-benzoylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-5-bromo-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(2-benzoylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-5-bromo-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 137065402 |
| Molecular Formula | C20H15BrN2O6S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-[4-[(Z)-(2-benzoylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-5-bromo-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C20H15BrN2O6S/c1-28-14-7-12(13(21)9-15(14)29-10-17(24)25)8-16-19(27)23-20(30-16)22-18(26)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,24,25)(H,22,23,26,27)/b16-8- |
| InChIKey | GYSAQKWGPRZISI-PXNMLYILSA-N |
| XLogP | 3.32 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|