C18H15BrO3 — CID 2697166
(2E)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 2697166) has the molecular formula C18H15BrO3 and a molecular weight of 359.22 g/mol. Its IUPAC name is (2E)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-inden-1-one.
| Compound Name | (2E)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 2697166 |
| Molecular Formula | C18H15BrO3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (2E)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | COc1cc(Br)c(/C=C2\Cc3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H15BrO3/c1-21-16-9-12(15(19)10-17(16)22-2)8-13-7-11-5-3-4-6-14(11)18(13)20/h3-6,8-10H,7H2,1-2H3/b13-8+ |
| InChIKey | HWZZADVQKQYNOB-MDWZMJQESA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|