C17H13BrO4 — CID 60593765
(2Z)-2-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one (PubChem CID 60593765) has the molecular formula C17H13BrO4 and a molecular weight of 361.19 g/mol. Its IUPAC name is (2Z)-2-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one.
| Compound Name | (2Z)-2-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one |
|---|---|
| PubChem CID | 60593765 |
| Molecular Formula | C17H13BrO4 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | (2Z)-2-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one |
| SMILES | COc1cc(/C=C2/Cc3c(O)cccc3C2=O)c(Br)cc1O |
| InChI | InChI=1S/C17H13BrO4/c1-22-16-7-9(13(18)8-15(16)20)5-10-6-12-11(17(10)21)3-2-4-14(12)19/h2-5,7-8,19-20H,6H2,1H3/b10-5- |
| InChIKey | RISXNQZXPDGAIF-YHYXMXQVSA-N |
| XLogP | 3.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|