C17H11F3O2 — CID 99871922
(2E)-4-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one (PubChem CID 99871922) has the molecular formula C17H11F3O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is (2E)-4-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one.
| Compound Name | (2E)-4-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 99871922 |
| Molecular Formula | C17H11F3O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2E)-4-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C/c2cccc(C(F)(F)F)c2)Cc2c(O)cccc21 |
| InChI | InChI=1S/C17H11F3O2/c18-17(19,20)12-4-1-3-10(8-12)7-11-9-14-13(16(11)22)5-2-6-15(14)21/h1-8,21H,9H2/b11-7+ |
| InChIKey | YFAFTPDRWLTIQR-YRNVUSSQSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|