C18H12F3NO3 — CID 46677979
2,2,2-trifluoro-N-[3-[(Z)-(7-hydroxy-3-oxo-1H-inden-2-ylidene)methyl]phenyl]acetamide (PubChem CID 46677979) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[(Z)-(7-hydroxy-3-oxo-1H-inden-2-ylidene)methyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[(Z)-(7-hydroxy-3-oxo-1H-inden-2-ylidene)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46677979 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[(Z)-(7-hydroxy-3-oxo-1H-inden-2-ylidene)methyl]phenyl]acetamide |
| SMILES | O=C1/C(=C\c2cccc(NC(=O)C(F)(F)F)c2)Cc2c(O)cccc21 |
| InChI | InChI=1S/C18H12F3NO3/c19-18(20,21)17(25)22-12-4-1-3-10(8-12)7-11-9-14-13(16(11)24)5-2-6-15(14)23/h1-8,23H,9H2,(H,22,25)/b11-7- |
| InChIKey | CIHHSWOOZGPORF-XFFZJAGNSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|