C14H10F3N3O — CID 127264780
2,2,2-trifluoro-N-[3-(2-pyrimidin-4-ylethenyl)phenyl]acetamide (PubChem CID 127264780) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(2-pyrimidin-4-ylethenyl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(2-pyrimidin-4-ylethenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 127264780 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(2-pyrimidin-4-ylethenyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(C=Cc2ccncn2)c1)C(F)(F)F |
| InChI | InChI=1S/C14H10F3N3O/c15-14(16,17)13(21)20-12-3-1-2-10(8-12)4-5-11-6-7-18-9-19-11/h1-9H,(H,20,21) |
| InChIKey | UEGNIGHFJQUUOY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |