C17H11F3N2O4 — CID 46677879
2,2,2-trifluoro-N-[3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 46677879) has the molecular formula C17H11F3N2O4 and a molecular weight of 364.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46677879 |
| Molecular Formula | C17H11F3N2O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[(E)-3-(4-nitrophenyl)-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | O=C(/C=C/c1cccc(NC(=O)C(F)(F)F)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H11F3N2O4/c18-17(19,20)16(24)21-13-3-1-2-11(10-13)4-9-15(23)12-5-7-14(8-6-12)22(25)26/h1-10H,(H,21,24)/b9-4+ |
| InChIKey | WFZKHOHJBNYKBD-RUDMXATFSA-N |
| XLogP | 3.99 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|