C8H5F3N2O3 — CID 616367
2,2,2-trifluoro-N-(4-nitrophenyl)acetamide (PubChem CID 616367) has the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-nitrophenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 616367 |
| Molecular Formula | C8H5F3N2O3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2O3/c9-8(10,11)7(14)12-5-1-3-6(4-2-5)13(15)16/h1-4H,(H,12,14) |
| InChIKey | BLMWCZBKCOBVAM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|