C29H20N4O7 — CID 3092314
4-nitro-N-[3-[3-[3-[(4-nitrobenzoyl)amino]phenyl]-3-oxoprop-1-enyl]phenyl]benzamide (PubChem CID 3092314) has the molecular formula C29H20N4O7 and a molecular weight of 536.50 g/mol. Its IUPAC name is 4-nitro-N-[3-[3-[3-[(4-nitrobenzoyl)amino]phenyl]-3-oxoprop-1-enyl]phenyl]benzamide.
| Compound Name | 4-nitro-N-[3-[3-[3-[(4-nitrobenzoyl)amino]phenyl]-3-oxoprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3092314 |
| Molecular Formula | C29H20N4O7 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 4-nitro-N-[3-[3-[3-[(4-nitrobenzoyl)amino]phenyl]-3-oxoprop-1-enyl]phenyl]benzamide |
| SMILES | O=C(C=Cc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)c1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C29H20N4O7/c34-27(22-4-2-6-24(18-22)31-29(36)21-10-14-26(15-11-21)33(39)40)16-7-19-3-1-5-23(17-19)30-28(35)20-8-12-25(13-9-20)32(37)38/h1-18H,(H,30,35)(H,31,36) |
| InChIKey | MRDQSJXWOSFAHP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|